Alkanes Worksheet

  1. Determine the number of carbons in the longest continuous chain. This is the parent hydrocarbon (“last name”). 

    2.  

     

     

  2. Any groups that are not part of the chain continuous chain are substituents.  Number the chain in the direction that gives the substituent the lower number.  Number are used for systematic names only (never for common names).

       

    • Name

    3.  

     

     

  3. Substituents are listed in alphabetical order.  A number and word are separated by a hyphen: numbers are separated by commas.  Prefixes like di, tri and tetra are ignored when alphabetizing.

      4.  

    1. Name:

      2.  

       

    2. If the substituent is a branched chain then you will need to use further specialized naming. 

         

      • Name:

     

     

  4. Only if the same set of numbers is obtained in both directions does the first group cited get the lower number.

       

    • Name:



    5.  

     

     

  5. In the case of two hydrocarbon chains with the same number of carbons, choose the parent to be one with more substituents.

       

    • Name


    6.  

     

     

  6. Give the systematic name for the following:

      2.  

       


      3.  

       

       

    3. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2

 

Home . Support Us . Contact Us